Urolithin B (1139-83-9 factory ໂຮງງານຜູ້ຜະລິດ

Urolithin B

ພະຈິກ 9, 2020

Urolithin BSpecifications

ຊື່ຂອງທ່ານ: Urolithin B
ຊື່ທາງເຄມີ: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139​, 83​, 9
ສູດເຄມີ: C13H8O3
ນ້ໍາຫນັກຂອງມະເລັງ: 212.2 g / mol
ສີ:  ຝຸ່ນສີຂາວ
ຫຼັກ InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
ລະຫັດ SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ການທໍາງານ: Urolithin B ສາມາດປັບປຸງການເຮັດວຽກຂອງ mitochondrial ແລະກ້າມເນື້ອ.

Urolithin B ສາມາດປັບປຸງຄວາມແຂງແຮງຂອງກ້າມເນື້ອແລະຄວາມອົດທົນໃນລະຫວ່າງການເຖົ້າແກ່.

ຄໍາຮ້ອງສະຫມັກ: Urolithin B ແມ່ນທາດຍ່ອຍອາຫານຈຸລິນຊີໃນ ລຳ ໄສ້ຂອງ ellagitannis ແລະວາງສະແດງສານຕ້ານອະນຸມູນອິດສະຫຼະທີ່ມີປະສິດຕິພາບສູງຂື້ນຢູ່ກັບລະບົບແລະເງື່ອນໄຂການຍື່ນຍັນ. Urolithin B ຍັງສາມາດສະແດງກິດຈະ ກຳ ເອດໂຕຣເຈນແລະ / ຫຼືກິດຈະ ກຳ ຕ້ານ estrogen.
ຄວາມຍືດຫຍຸ່ນ: ລະລາຍໄດ້ງ່າຍໃນ N, N-dimethylformamide ແລະ dimethylmethylene. Sulfone, ລະລາຍເລັກນ້ອຍໃນ methanol, ethanol, ແລະ ethyl acetate
Temp Storage: Hygroscopic, -20 C Freezer, ພາຍໃຕ້ບັນຍາກາດ inert
ເງື່ອນໄຂການຂົນສົ່ງ: ສົ່ງພາຍໃຕ້ອຸນຫະພູມອາກາດເປັນສານເຄມີທີ່ບໍ່ເປັນອັນຕະລາຍ. ຜະລິດຕະພັນນີ້ແມ່ນມີຄວາມຫມັ້ນຄົງພຽງພໍສໍາລັບສອງສາມອາທິດໃນລະຫວ່າງການຂົນສົ່ງທົ່ວໄປແລະໃຊ້ເວລາໃນພາສີ.