ຜົງ Urolithin B

ພະຈິກ 9, 2020

Cofttek ເປັນຜູ້ຜະລິດຜົງ Urolithin B ທີ່ດີທີ່ສຸດໃນປະເທດຈີນ. ໂຮງງານຂອງພວກເຮົາມີລະບົບການຈັດການການຜະລິດທີ່ສົມບູນແບບ (ISO9001 & ISO14001), ມີ ກຳ ລັງການຜະລິດ 200 ກິໂລຕໍ່ເດືອນ.

 


ສະຖານະພາບ: In Mass Production
ຫນ່ວຍ: 1kg / ກະເປົາ, 25kg / ກອງ

Urolithin BSpecifications

ຊື່ຂອງທ່ານ: Urolithin ຂ
ຊື່ທາງເຄມີ: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-one
CAS: 1139​, 83​, 9
ສູດເຄມີ: C13H8O3
ນ້ໍາຫນັກຂອງມະເລັງ: 212.2 g / mol
ສີ:  ຝຸ່ນສີຂາວ
ຫຼັກ InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
ລະຫັດ SMILES: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
ການທໍາງານ: Urolithin B ສາມາດປັບປຸງການເຮັດວຽກຂອງ mitochondrial ແລະກ້າມເນື້ອ.

Urolithin B ສາມາດປັບປຸງຄວາມແຂງແຮງຂອງກ້າມເນື້ອແລະຄວາມອົດທົນໃນລະຫວ່າງການເຖົ້າແກ່.

ຄໍາຮ້ອງສະຫມັກ: Urolithin B ແມ່ນທາດຍ່ອຍອາຫານຈຸລິນຊີໃນ ລຳ ໄສ້ຂອງ ellagitannis ແລະວາງສະແດງສານຕ້ານອະນຸມູນອິດສະຫຼະທີ່ມີປະສິດຕິພາບສູງຂື້ນຢູ່ກັບລະບົບແລະເງື່ອນໄຂການຍື່ນຍັນ. Urolithin B ຍັງສາມາດສະແດງກິດຈະ ກຳ ເອດໂຕຣເຈນແລະ / ຫຼືກິດຈະ ກຳ ຕ້ານ estrogen.
ຄວາມຍືດຫຍຸ່ນ: ລະລາຍໄດ້ງ່າຍໃນ N, N-dimethylformamide ແລະ dimethylmethylene. Sulfone, ລະລາຍເລັກນ້ອຍໃນ methanol, ethanol, ແລະ ethyl acetate
Temp Storage: Hygroscopic, -20 C Freezer, ພາຍໃຕ້ບັນຍາກາດ inert
ເງື່ອນໄຂການຂົນສົ່ງ: ສົ່ງພາຍໃຕ້ອຸນຫະພູມອາກາດເປັນສານເຄມີທີ່ບໍ່ເປັນອັນຕະລາຍ. ຜະລິດຕະພັນນີ້ແມ່ນມີຄວາມຫມັ້ນຄົງພຽງພໍສໍາລັບສອງສາມອາທິດໃນລະຫວ່າງການຂົນສົ່ງທົ່ວໄປແລະໃຊ້ເວລາໃນພາສີ.

 

Urolithin ຂ NMR Spectrum

Urolithin B (1139-83-9)-NMR Spectrum

 

ຖ້າທ່ານຕ້ອງການ COA, MSDS, HNMR ສຳ ລັບແຕ່ລະຜະລິດຕະພັນແລະຂໍ້ມູນອື່ນໆ, ກະລຸນາຕິດຕໍ່ຫາພວກເຮົາ ຜູ້​ຈັດ​ການ​ຝ່າຍ​ການ​ຕະ​ຫຼາດ.

 

ການແນະ ນຳ ກ່ຽວກັບ Urolithins

Urolithins ແມ່ນທາດ metabolites ຂັ້ນສອງຂອງກົດ ellagic ທີ່ມາຈາກ ellagitannins. ໃນມະນຸດ ellagitannins ຖືກປ່ຽນໂດຍ microflora ລຳ ໄສ້ເປັນກົດ ellagic ເຊິ່ງຖືກປ່ຽນເປັນ urolithins A, urolithin B, urolithin C ແລະ urolithin D ໃນ ລຳ ໄສ້ໃຫຍ່.

Urolithin A (UA) ແມ່ນທາດແປ້ງທີ່ແຜ່ຫຼາຍທີ່ສຸດຂອງ ellagitannins. ເຖິງຢ່າງໃດກໍ່ຕາມ, urolithin A ບໍ່ຮູ້ວ່າເກີດຂື້ນຕາມ ທຳ ມະຊາດໃນແຫຼ່ງອາຫານໃດໆ.

Urolithin B (UB) ແມ່ນທາດຍ່ອຍທາດທີ່ອຸດົມສົມບູນທີ່ຜະລິດຢູ່ໃນ ລຳ ໄສ້ຜ່ານການຫັນເປັນຂອງ ellagitannins. ຜະລິດຕະພັນ Urolithin B ແມ່ນຜະລິດຕະພັນສຸດທ້າຍພາຍຫຼັງທີ່ໄດ້ຮັບອະນຸຍາດຈາກ urolithin ອື່ນໆ. Urolithin B ພົບໃນຍ່ຽວເປັນ urolithin B glucuronide.

Urolithin A 8-Methyl Ether ແມ່ນຜະລິດຕະພັນລະຫວ່າງກາງໃນການສັງເຄາະຂອງ Urolithin A. ມັນເປັນທາດຍ່ອຍທາດຍ່ອຍທີສອງທີ່ ສຳ ຄັນຂອງ ellagitannin ແລະມີສານຕ້ານອະນຸມູນອິດສະຫລະແລະຕ້ານອັກເສບ.

 

ກົນໄກການປະຕິບັດຂອງ urolithin A ແລະ B

rol Urolithin A ຊ່ວຍໃນການເປັນໂຣກເຍື່ອຫຸ້ມສະຫມອງ

Mitophagy ແມ່ນຮູບແບບ ໜຶ່ງ ຂອງ autophagy ທີ່ຊ່ວຍ ກຳ ຈັດ mitochondrial ທີ່ເສຍຫາຍ ສຳ ລັບການເຮັດວຽກທີ່ດີທີ່ສຸດຂອງພວກມັນ. Autophagy ໝາຍ ເຖິງຂະບວນການທົ່ວໄປທີ່ເນື້ອໃນ cytoplasmic ຖືກເສື່ອມໂຊມແລະສົ່ງຜົນໃຫ້ເກີດ ໃໝ່ ໃນຂະນະທີ່ mitophagy ແມ່ນການເຊື່ອມໂຊມແລະການ ນຳ ກັບມາໃຊ້ ໃໝ່ ຂອງ mitochondria.

ໃນລະຫວ່າງການສູງອາຍຸການຫຼຸດລົງຂອງ autophagy ແມ່ນລັກສະນະຫນຶ່ງທີ່ເຮັດໃຫ້ການເຮັດວຽກຂອງ mitochondrial ຫຼຸດລົງ. ຍິ່ງໄປກວ່ານັ້ນ, ຄວາມກົດດັນຜຸພັງຍັງສາມາດນໍາໄປສູ່ການເປັນໂຣກຕັບແຂງຕໍ່າ. Urolithin A ມີຄວາມສາມາດໃນການ ກຳ ຈັດ mitochondria ທີ່ຖືກ ທຳ ລາຍຜ່ານທາງ autophagy ທີ່ເລືອກໄດ້.

properties ສານຕ້ານອະນຸມູນອິດສະຫຼະ

ຄວາມກົດດັນຂອງຜຸພັງເກີດຂື້ນເມື່ອມີຄວາມບໍ່ສົມດຸນລະຫວ່າງສານອະນຸມູນອິດສະຫຼະແລະສານຕ້ານອະນຸມູນອິດສະຫຼະໃນຮ່າງກາຍ. ສານຕ້ານອະນຸມູນອິດສະລະເຫລົ່ານີ້ສ່ວນຫຼາຍມັກກ່ຽວຂ້ອງກັບພະຍາດ ຊຳ ເຮື້ອຫລາຍຢ່າງເຊັ່ນໂຣກຫົວໃຈວາຍ, ໂຣກເບົາຫວານແລະມະເຮັງ.

Urolithins A ແລະ B ສະແດງຜົນກະທົບທີ່ເປັນສານຕ້ານອະນຸມູນອິດສະຫຼະໂດຍຜ່ານຄວາມສາມາດຂອງມັນໃນການຫຼຸດຜ່ອນທາດອະນຸມູນອິດສະຫຼະແລະໂດຍສະເພາະລະດັບຊະນິດອົກຊີເຈນທີ່ລະລາຍ (ROS) ແລະຍັງສາມາດຍັບຍັ້ງການລະລາຍຂອງ lipid ໃນບາງປະເພດຂອງຈຸລັງ.

ຍິ່ງໄປກວ່ານັ້ນ, urolithins ແມ່ນສາມາດຍັບຍັ້ງເອນໄຊອົກຊີບາງຊະນິດ, ລວມທັງ monoamine oxidase A ແລະ tyrosinase.

properties ຄຸນສົມບັດຕ້ານການອັກເສບ

ການອັກເສບແມ່ນຂະບວນການ ທຳ ມະຊາດທີ່ຮ່າງກາຍຂອງພວກເຮົາຕໍ່ສູ້ກັບສິ່ງທີ່ລົ້ມເຫຼວເຊັ່ນ: ການຕິດເຊື້ອ, ການບາດເຈັບແລະເຊື້ອຈຸລິນຊີ. ເຖິງຢ່າງໃດກໍ່ຕາມ, ການອັກເສບເຮື້ອຮັງອາດເປັນອັນຕະລາຍຕໍ່ຮ່າງກາຍເນື່ອງຈາກວ່າສິ່ງນີ້ກ່ຽວຂ້ອງກັບຄວາມຜິດປົກກະຕິຕ່າງໆເຊັ່ນ: ໂລກຫອບຫືດ, ບັນຫາຫົວໃຈແລະມະເລັງ. ການອັກເສບເຮື້ອຮັງສາມາດເກີດຂື້ນຍ້ອນການອັກເສບສ້ວຍແຫຼມທີ່ບໍ່ໄດ້ຮັບການປິ່ນປົວ, ການຕິດເຊື້ອຫຼືແມ້ກະທັ້ງສານອະນຸມູນອິດສະຫຼະໃນຮ່າງກາຍ.

Urolithins A ແລະ B ສະແດງຄຸນສົມບັດຕ້ານການອັກເສບໂດຍການຍັບຍັ້ງການຜະລິດໄນໂຕຣເຈນອອກໄຊ. ພວກມັນໂດຍສະເພາະຍັບຍັ້ງທາດໂປຼຕີນຈາກທາດໄນໂຕຣເຈນອອກລິດ (iNOS) ແລະການສະແດງອອກ mRNA ທີ່ຮັບຜິດຊອບຕໍ່ການອັກເສບ.

effects ຜົນກະທົບຕໍ່ຕ້ານຈຸລິນຊີ

ຈຸລິນຊີປະກອບມີເຊື້ອແບັກທີເຣັຍ, ເຊື້ອເຫັດແລະໄວຣັດເກີດຂື້ນຕາມ ທຳ ມະຊາດໃນສະພາບແວດລ້ອມແລະແມ່ນແຕ່ໃນຮ່າງກາຍຂອງມະນຸດ. ເຖິງຢ່າງໃດກໍ່ຕາມ, ເຊື້ອຈຸລິນຊີ ຈຳ ນວນ ໜຶ່ງ ທີ່ເອີ້ນວ່າເຊື້ອພະຍາດສາມາດກໍ່ໃຫ້ເກີດພະຍາດຕິດຕໍ່ເຊັ່ນ: ໄຂ້ຫວັດໃຫຍ່, ໂຣກຫັດແລະໄຂ້ຍຸງ.

Urolithin A ແລະ B ແມ່ນສາມາດສະແດງກິດຈະ ກຳ ຕ້ານອະນຸມູນອິດສະຫຼະໂດຍການຢັບຢັ້ງຄວາມຮູ້ສຶກຂອງກຸ່ມໂຄ ຣຳ. ຄວາມຮູ້ສຶກຂອງກຸ່ມໂຄ ຣຳ ແມ່ນຮູບແບບຂອງການສື່ສານແບັກທີເລຍທີ່ຊ່ວຍໃຫ້ເຊື້ອແບັກທີເຣັຍສາມາດກວດພົບແລະຄວບຄຸມຂະບວນການທີ່ກ່ຽວຂ້ອງກັບການຕິດເຊື້ອເຊັ່ນ: ໄວຣັດແລະການເຄື່ອນໄຫວ.

●ຫ້າມຍັບຍັ້ງທາດໂປຼຕີນ

Glycation ໝາຍ ເຖິງການຕິດນ້ ຳ ຕານທີ່ບໍ່ແມ່ນທາດ enzymatic ໃສ່ກັບ lipid ຫຼືທາດໂປຼຕີນ. ມັນເປັນທາດຊີວະພາບທີ່ ສຳ ຄັນໃນໂລກເບົາຫວານແລະຄວາມຜິດປົກກະຕິອື່ນໆພ້ອມທັງຄວາມເຖົ້າແກ່.

glycation ທາດໂປຼຕີນສູງແມ່ນຜົນກະທົບຂັ້ນສອງຂອງ hyperglycemia ມີບົດບາດຕົ້ນຕໍໃນຄວາມຜິດປົກກະຕິທີ່ກ່ຽວຂ້ອງກັບ cardiovascular ເຊັ່ນ: ພະຍາດເບົາຫວານແລະໂຣກ Alzheimer.

Urolithin A ແລະ B ມີຄຸນສົມບັດຕ້ານ glycative ທີ່ຂື້ນກັບປະລິມານທີ່ເປັນເອກະລາດຈາກກິດຈະ ກຳ ຕ້ານອະນຸມູນອິດສະຫຼະຂອງພວກມັນ.

 

ຜົນປະໂຫຍດຂອງ Urolithin B

ອາຫານເສີມ Urolithin B ຍັງມີຜົນປະໂຫຍດຕໍ່ສຸຂະພາບຫລາຍຢ່າງແລະສ່ວນຫລາຍມັນຄ້າຍຄືກັນກັບຄຸນປະໂຫຍດຂອງ urolithin A.

(1) ຄວາມສາມາດຕ້ານມະເລັງ
ຄຸນສົມບັດຕ້ານການອັກເສບຂອງ urolithin B ເຮັດໃຫ້ມັນເປັນຜູ້ສະ ໝັກ ທີ່ດີໃນການຕໍ່ສູ້ກັບມະເລັງ. ນັກຄົ້ນຄວ້າບາງຄົນໄດ້ລາຍງານທ່າແຮງເຫຼົ່ານີ້ຢູ່ໃນຈຸລັງ fibroblasts, microphages ແລະຈຸລັງ endothelial.

ການສຶກສາໄດ້ລາຍງານວ່າ UB ຍັບຍັ້ງໂຣກມະເຮັງປະເພດຕ່າງໆເຊັ່ນ: ມະເຮັງຕ່ອມລູກ ໝາກ, ມະເລັງ ລຳ ໄສ້ແລະພົກຍ່ຽວ.

ໃນການສຶກສາທີ່ກ່ຽວຂ້ອງກັບຈຸລັງມະເລັງ ລຳ ໄສ້ຂອງມະນຸດ, ellagitannins, ກົດ ellagic ແລະ urolithins A ແລະ B ໄດ້ຖືກປະເມີນຜົນ ສຳ ລັບຄວາມສາມາດຕ້ານມະເລັງຂອງພວກມັນ. ພວກເຂົາໄດ້ລາຍງານວ່າການປິ່ນປົວທັງ ໝົດ ສາມາດຍັບຍັ້ງການເຕີບໂຕຂອງເຊວມະເລັງ. ພວກມັນໄດ້ຍັບຍັ້ງການຂະຫຍາຍຕົວຂອງເຊວມະເລັງໂດຍຜ່ານການຈັບກຸມວົງຈອນໃນແຕ່ລະໄລຍະແລະໂດຍການກະຕຸ້ນໃຫ້ມີໂຣກ apoptosis.

(2) ສາມາດຊ່ວຍໃນການຕໍ່ສູ້ກັບຄວາມກົດດັນຜຸພັງ
Urolithin B ມີຄຸນສົມບັດຕ້ານອະນຸມູນອິດສະຫຼະທີ່ດີເລີດໂດຍຜ່ານການຫຼຸດຜ່ອນລະດັບຊະນິດຂອງອົກຊີເຈນທີ່ມີປະຕິກິລິຍາແລະການລະລາຍຂອງ lipid ໃນບາງປະເພດຂອງຈຸລັງ. ລະດັບສູງຂອງ ROS ແມ່ນກ່ຽວຂ້ອງກັບຄວາມຜິດປົກກະຕິຫຼາຍຢ່າງເຊັ່ນ: ພະຍາດ Alzheimer.

ໃນການສຶກສາທີ່ມີຈຸລັງ neuronal ໄດ້ປະເຊີນກັບຄວາມກົດດັນຂອງຜຸພັງ, ການເສີມ urolithin B ເຊັ່ນດຽວກັນກັບ urolithin A ໄດ້ຖືກພົບເຫັນເພື່ອປົກປ້ອງຈຸລັງຕ້ານການຜຸພັງດັ່ງນັ້ນຈຶ່ງຊ່ວຍເພີ່ມຄວາມຢູ່ລອດຂອງເຊນ.

(3) Urolithin B ໃນການເພີ່ມຄວາມ ຈຳ
Urolithin b ໄດ້ຖືກລາຍງານວ່າປັບປຸງຄວາມສາມາດໃນການກີດຂວາງເສັ້ນເລືອດ. ນີ້ຊ່ວຍເພີ່ມການເຮັດວຽກຂອງມັນສະຫມອງ.

ການສຶກສາສະແດງໃຫ້ເຫັນວ່າ urolithin B ສາມາດຊ່ວຍເພີ່ມຄວາມຊົງ ຈຳ ທີ່ດີຂື້ນໂດຍການປັບປຸງການເຮັດວຽກຂອງມັນສະ ໝອງ ທົ່ວໄປ.

(4) ປ້ອງກັນການສູນເສຍກ້າມເນື້ອ
ການສູນເສຍກ້າມສາມາດເກີດຂື້ນຍ້ອນເຫດຜົນຕ່າງໆເຊັ່ນ: ຄວາມຜິດປົກກະຕິ, ຄວາມເຖົ້າແກ່ແລະການຂາດທາດໂປຼຕີນໃນອາຫານ. ມີຫຼາຍມາດຕະການທີ່ຈະຢຸດ, ຈຳ ກັດຫຼືດີກວ່າເພື່ອປ້ອງກັນການສູນເສຍກ້າມເນື້ອລວມທັງການອອກ ກຳ ລັງກາຍ, ຢາແລະກົດອະມິໂນເຊັ່ນດຽວກັນກັບໂພລີໂຟນໂນສາມາດ ນຳ ໃຊ້ໄດ້.

Urolithins ສາມາດຖືກຈັດປະເພດເປັນ polyphenols ແລະມີບົດບາດໃນການປ້ອງກັນການສູນເສຍກ້າມເນື້ອໂດຍການກະຕຸ້ນການສັງເຄາະທາດໂປຼຕີນຈາກກ້າມເນື້ອແລະຍັງເຮັດໃຫ້ການເຊື່ອມໂຊມຊ້າລົງ.

ໃນການສຶກສາກັບ ໜູ, ການເສີມ Urolithin B ປະຕິບັດໃນໄລຍະເວລາ ໜຶ່ງ ໄດ້ຖືກພົບເຫັນວ່າຊ່ວຍເພີ່ມການພັດທະນາກ້າມເນື້ອຂອງພວກເຂົາຍ້ອນວ່າກ້າມຊີ້ນໄດ້ເຫັນວ່າໃຫຍ່ຂື້ນ.

(5) Urolithin B ຕ້ານການອັກເສບ
Urolithin B ມີຄຸນສົມບັດຕ້ານການອັກເສບໂດຍການຫຼຸດຜ່ອນເຄື່ອງ ໝາຍ ການອັກເສບສ່ວນໃຫຍ່.

ໃນການສຶກສາກ່ຽວກັບ ໜູ ທີ່ມີເສັ້ນປະສາດຊະນິດ ໃໝ່, Urolithin B ໄດ້ຖືກກວດພົບວ່າເຮັດໃຫ້ເປັນອັນຕະລາຍຕໍ່ການບາດເຈັບຂອງ ໝາກ ໄຂ່ຫຼັງ. ມັນໄດ້ເສີມຂະຫຍາຍການເຮັດວຽກຂອງ ໝາກ ໄຂ່ຫຼັງ, ໂມເລກຸນຂອງ ໝາກ ໄຂ່ຫຼັງພ້ອມທັງຫຼຸດຜ່ອນເຄື່ອງ ໝາຍ ການບາດເຈັບຂອງ ໝາກ ໄຂ່ຫຼັງ. ນີ້ສະແດງໃຫ້ເຫັນວ່າ UB ສາມາດຫຼຸດຜ່ອນການອັກເສບຂອງ ໝາກ ໄຂ່ຫຼັງ.

(6) ຜົນປະໂຫຍດຮ່ວມຂອງ urolithin A ແລະ B
ຜົນກະທົບຂອງ Synergistic ຍັງໄດ້ຖືກລາຍງານໃນການລວມກັນຂອງ urolithin A ແລະ B ໃນການເຮັດວຽກຂອງມັນສະຫມອງແລະຄວາມສາມາດ. ການສຶກສາລະບຸວ່າການປະສົມປະສານນີ້ສາມາດ ນຳ ໃຊ້ເຂົ້າໃນການຮັກສາຫຼືປ້ອງກັນພະຍາດທີ່ກ່ຽວຂ້ອງກັບໂລກຊືມເສົ້າເຊັ່ນ: ຄວາມກັງວົນໃຈຫລືໂຣກ Alzheimer.

ຜົນປະໂຫຍດອື່ນໆທີ່ກ່ຽວຂ້ອງກັບ urolithins ແມ່ນ;

  • neuroprotective
  • ໂຣກ E -book ອາຊິດລະລາຍ

 

ແຫຼ່ງອາຫານຂອງ Urolithin A ແລະ B

Urolithins ແມ່ນບໍ່ເປັນທີ່ຮູ້ຈັກທີ່ຈະພົບເຫັນໂດຍ ທຳ ມະຊາດໃນແຫຼ່ງອາຫານໃດໆ. ມັນແມ່ນຜະລິດຕະພັນຂອງການຫັນປ່ຽນຂອງອາຊິດ ellagic ເຊິ່ງໄດ້ມາຈາກ ellagitannins. Ellagitannins ຖືກປ່ຽນເປັນກົດ ellagic ໂດຍ ລຳ ໄສ້ microbiota ແລະກົດ ellagic ຈະຖືກປ່ຽນເປັນທາດ metabolites (urolithins) ໃນ ລຳ ໄສ້ໃຫຍ່.

Ellagitannins ເກີດຂື້ນຕາມ ທຳ ມະຊາດໃນແຫຼ່ງອາຫານເຊັ່ນ: ໝາກ ພິລາ, ໝາກ ໄມ້ປ່າລວມທັງ ໝາກ ສະຕໍເບີຣີ, ໝາກ ສະຕໍເບີຣີ, ໝາກ ສີດາແລະ blackberries, ໝາກ ອະງຸ່ນ muscadine, almonds, ໝາກ ກ້ຽງ, ຊາແລະແກ່ນເຊັ່ນ: ໝາກ ໄມ້ແລະແກ່ນ ໝາກ ກໍ່ເຊັ່ນດຽວກັບເຄື່ອງດື່ມທີ່ມີອາຍຸແກ່ oak ຕົວຢ່າງເຊັ່ນເຫຼົ້າແວງແດງແລະເຫຼົ້າຂາວຈາກ ຖັງໄມ້ໂອກ.

ດັ່ງນັ້ນພວກເຮົາສາມາດສະຫຼຸບອາຫານ urolithin A ແລະອາຫານ urolithin B ແມ່ນອາຫານທີ່ອຸດົມດ້ວຍ ellagitannin. ມັນເປັນມູນຄ່າທີ່ສັງເກດວ່າຊີວະພາບ ellagitannin ແມ່ນມີຂໍ້ຈໍາກັດຫຼາຍໃນຂະນະທີ່ທາດແປ້ງມັດທະຍົມ (urolithins) ແມ່ນສາມາດໃຊ້ໄດ້ງ່າຍ.

ການລະບາຍແລະການຜະລິດຂອງ Urolithins ແຕກຕ່າງກັນຢ່າງກວ້າງຂວາງໃນບັນດາບຸກຄົນນັບຕັ້ງແຕ່ການປ່ຽນໃຈເຫລື້ອມໃສຈາກ ellagitannins ອີງໃສ່ microbiota ໃນ ລຳ ໄສ້. ມີເຊື້ອແບັກທີເຣັຍສະເພາະທີ່ກ່ຽວຂ້ອງກັບການປ່ຽນໃຈເຫລື້ອມໃສເຫລົ່ານີ້ແລະແຕກຕ່າງກັນລະຫວ່າງບຸກຄົນທີ່ບາງຄົນມີຈຸລິນຊີທີ່ສູງ, ຕໍ່າຫຼືບໍ່ມີ. ແຫຼ່ງອາຫານຍັງແຕກຕ່າງກັນໃນລະດັບ ellagitannins ຂອງພວກເຂົາ. ດັ່ງນັ້ນຜົນປະໂຫຍດທີ່ເປັນໄປໄດ້ຂອງ ellagitannins ແຕກຕ່າງກັນຈາກແຕ່ລະບຸກຄົນ.

 

ອາຫານເສີມ Urolithin A ແລະ B

ອາຫານເສີມ Urolithin A ພ້ອມທັງອາຫານເສີມ Urolithin B ແມ່ນພົບເຫັນງ່າຍໃນຕະຫຼາດເປັນການເສີມແຫຼ່ງອາຫານທີ່ອຸດົມໄປດ້ວຍ ellagitannin. ອາຫານເສີມ Urolithin A ຍັງມີພ້ອມ. ສ່ວນໃຫຍ່ອາຫານເສີມ ໝາກ ພິລາໄດ້ຖືກຂາຍແລະ ນຳ ໃຊ້ຢ່າງ ສຳ ເລັດຜົນ. ອາຫານເສີມເຫລົ່ານີ້ໄດ້ຖືກສັງເຄາະຈາກ ໝາກ ໄມ້ຫລືແກ່ນແລະປະກອບເປັນທາດແຫຼວຫລືຜົງ.

ເນື່ອງຈາກການປ່ຽນແປງຂອງຄວາມເຂັ້ມຂົ້ນຂອງ ellagitannins ໃນອາຫານທີ່ແຕກຕ່າງກັນ, ລູກຄ້າຂອງ urolithin ຊື້ມັນໃສ່ໃນການພິຈາລະນາແຫຼ່ງອາຫານ. ສິ່ງດຽວກັນນີ້ໃຊ້ໃນເວລາຊອກຫາຜົງ urolithin B ຫຼືທາດແຫຼວເສີມ.

ການສຶກສາທາງຄລີນິກຂອງມະນຸດ ຈຳ ນວນ ໜ້ອຍ ທີ່ ດຳ ເນີນດ້ວຍຜົງ urolithin A ຫຼື B ບໍ່ໄດ້ລາຍງານຜົນຂ້າງຄຽງທີ່ຮ້າຍແຮງໃດໆຈາກການບໍລິຫານອາຫານເສີມເຫຼົ່ານີ້.

ກະສານອ້າງອີງ

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02). "ຊະຕາ ກຳ ທາງດ້ານການເຜົາຜານອາຫານຂອງ Ellagitannins: ຜົນກະທົບຕໍ່ສຸຂະພາບ, ແລະທັດສະນະການຄົ້ນຄ້ວາ ສຳ ລັບອາຫານທີ່ມີການປະດິດສ້າງໃ ”່". ການທົບທວນຄືນທີ່ສໍາຄັນໃນວິທະຍາສາດອາຫານແລະໂພຊະນາການ.
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (11 ພະຈິກ 2009). "Urolithins, ທາດຍ່ອຍອາຫານຂອງຈຸລິນຊີໃນລໍາໄສ້ຂອງ Pomegranate ellagitannins, ສະແດງກິດຈະກໍາຕ້ານອະນຸມູນອິດສະຫຼະທີ່ມີປະສິດທິພາບຢູ່ໃນການທົດສອບໂດຍໃຊ້ເຊນ." J Agric ອາຫານເຄມີ.
  3. Bodwell, Graham; Pottie, Ian; Nandaluru, Penchal (2011). “ ການສັງເຄາະທັງUົດຂອງ Urolithin M7 ທີ່ມີຄວາມຕ້ອງການເອເລັກໂຕຣນິກທີ່ກົງກັນຂ້າມກັບຄວາມຕ້ອງການ.”